C29H20O9 — CID 170990037
(1R,4R,15R,26S,27R)-11,18,20,27-tetrahydroxy-9,22-dimethylheptacyclo[13.10.2.01,17.04,26.05,14.07,12.019,24]heptacosa-5(14),7(12),8,10,17,19(24),20,22-octaene-3,6,13,16,25-pentone (PubChem CID 170990037) has the molecular formula C29H20O9 and a molecular weight of 512.47 g/mol. Its IUPAC name is (1R,4R,15R,26S,27R)-11,18,20,27-tetrahydroxy-9,22-dimethylheptacyclo[13.10.2.01,17.04,26.05,14.07,12.019,24]heptacosa-5(14),7(12),8,10,17,19(24),20,22-octaene-3,6,13,16,25-pentone.
| Compound Name | (1R,4R,15R,26S,27R)-11,18,20,27-tetrahydroxy-9,22-dimethylheptacyclo[13.10.2.01,17.04,26.05,14.07,12.019,24]heptacosa-5(14),7(12),8,10,17,19(24),20,22-octaene-3,6,13,16,25-pentone |
|---|---|
| PubChem CID | 170990037 |
| Molecular Formula | C29H20O9 |
| Molecular Weight | 512.47 g/mol |
| Exact Mass | 512.11 |
| IUPAC Name | (1R,4R,15R,26S,27R)-11,18,20,27-tetrahydroxy-9,22-dimethylheptacyclo[13.10.2.01,17.04,26.05,14.07,12.019,24]heptacosa-5(14),7(12),8,10,17,19(24),20,22-octaene-3,6,13,16,25-pentone |
| SMILES | Cc1cc(O)c2c(c1)C(=O)C1=C(C2=O)[C@H]2C(=O)C3=C(O)c4c(O)cc(C)cc4C(=O)[C@@]34CC(=O)[C@@H]1[C@@H]4[C@H]2O |
| InChI | InChI=1S/C29H20O9/c1-8-3-10-15(12(30)5-8)24(34)19-18(23(10)33)17-14(32)7-29-21(17)26(36)20(19)27(37)22(29)25(35)16-11(28(29)38)4-9(2)6-13(16)31/h3-6,17,20-21,26,30-31,35-36H,7H2,1-2H3/t17-,20+,21+,26-,29+/m0/s1 |
| InChIKey | NUCLBQRGFBCXQA-ABXALDTOSA-N |
| XLogP | 2.32 |
| TPSA | 166.27 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.47 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|