C18H26O5 — CID 170990077
6-[(1E,3E,5R,6S)-5,6-dihydroxyundeca-1,3-dienyl]-4-methoxy-3-methylpyran-2-one (PubChem CID 170990077) has the molecular formula C18H26O5 and a molecular weight of 322.40 g/mol. Its IUPAC name is 6-[(1E,3E,5R,6S)-5,6-dihydroxyundeca-1,3-dienyl]-4-methoxy-3-methylpyran-2-one.
| Compound Name | 6-[(1E,3E,5R,6S)-5,6-dihydroxyundeca-1,3-dienyl]-4-methoxy-3-methylpyran-2-one |
|---|---|
| PubChem CID | 170990077 |
| Molecular Formula | C18H26O5 |
| Molecular Weight | 322.40 g/mol |
| Exact Mass | 322.18 |
| IUPAC Name | 6-[(1E,3E,5R,6S)-5,6-dihydroxyundeca-1,3-dienyl]-4-methoxy-3-methylpyran-2-one |
| SMILES | CCCCC[C@H](O)[C@H](O)/C=C/C=C/c1cc(OC)c(C)c(=O)o1 |
| InChI | InChI=1S/C18H26O5/c1-4-5-6-10-15(19)16(20)11-8-7-9-14-12-17(22-3)13(2)18(21)23-14/h7-9,11-12,15-16,19-20H,4-6,10H2,1-3H3/b9-7+,11-8+/t15-,16+/m0/s1 |
| InChIKey | VUHADBPPXJGBPA-JKBWCZCISA-N |
| XLogP | 2.83 |
| TPSA | 79.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.40 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|