C15H22O3 — CID 170990122
(3aS,3bR,4R,6aS,7aR)-2,4-dihydroxy-3,3a,5,5-tetramethyl-3b,4,6,6a,7,7a-hexahydrocyclopenta[a]pentalen-1-one (PubChem CID 170990122) has the molecular formula C15H22O3 and a molecular weight of 250.34 g/mol. Its IUPAC name is (3aS,3bR,4R,6aS,7aR)-2,4-dihydroxy-3,3a,5,5-tetramethyl-3b,4,6,6a,7,7a-hexahydrocyclopenta[a]pentalen-1-one.
| Compound Name | (3aS,3bR,4R,6aS,7aR)-2,4-dihydroxy-3,3a,5,5-tetramethyl-3b,4,6,6a,7,7a-hexahydrocyclopenta[a]pentalen-1-one |
|---|---|
| PubChem CID | 170990122 |
| Molecular Formula | C15H22O3 |
| Molecular Weight | 250.34 g/mol |
| Exact Mass | 250.16 |
| IUPAC Name | (3aS,3bR,4R,6aS,7aR)-2,4-dihydroxy-3,3a,5,5-tetramethyl-3b,4,6,6a,7,7a-hexahydrocyclopenta[a]pentalen-1-one |
| SMILES | CC1=C(O)C(=O)[C@@H]2C[C@H]3CC(C)(C)[C@H](O)[C@H]3[C@]12C |
| InChI | InChI=1S/C15H22O3/c1-7-11(16)12(17)9-5-8-6-14(2,3)13(18)10(8)15(7,9)4/h8-10,13,16,18H,5-6H2,1-4H3/t8-,9-,10-,13+,15+/m0/s1 |
| InChIKey | IUAFWQDUTOONBT-YXRHHCIQSA-N |
| XLogP | 2.45 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.34 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |