C11H16O4 — CID 170990138
(7R,8R)-4-methoxy-7,8-dimethyl-5,7,8,8a-tetrahydro-4aH-pyrano[4,3-b]pyran-2-one (PubChem CID 170990138) has the molecular formula C11H16O4 and a molecular weight of 212.24 g/mol. Its IUPAC name is (7R,8R)-4-methoxy-7,8-dimethyl-5,7,8,8a-tetrahydro-4aH-pyrano[4,3-b]pyran-2-one.
| Compound Name | (7R,8R)-4-methoxy-7,8-dimethyl-5,7,8,8a-tetrahydro-4aH-pyrano[4,3-b]pyran-2-one |
|---|---|
| PubChem CID | 170990138 |
| Molecular Formula | C11H16O4 |
| Molecular Weight | 212.24 g/mol |
| Exact Mass | 212.10 |
| IUPAC Name | (7R,8R)-4-methoxy-7,8-dimethyl-5,7,8,8a-tetrahydro-4aH-pyrano[4,3-b]pyran-2-one |
| SMILES | COC1=CC(=O)OC2C1CO[C@H](C)[C@H]2C |
| InChI | InChI=1S/C11H16O4/c1-6-7(2)14-5-8-9(13-3)4-10(12)15-11(6)8/h4,6-8,11H,5H2,1-3H3/t6-,7-,8?,11?/m1/s1 |
| InChIKey | UKOGHKLGIQJYJB-LJISRJRGSA-N |
| XLogP | 1.11 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.24 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |