C15H26O2 — CID 170990150
2-[(2R,5R,6S)-5,9-dimethyl-1-oxaspiro[5.5]undec-9-en-2-yl]propan-2-ol (PubChem CID 170990150) has the molecular formula C15H26O2 and a molecular weight of 238.37 g/mol. Its IUPAC name is 2-[(2R,5R,6S)-5,9-dimethyl-1-oxaspiro[5.5]undec-9-en-2-yl]propan-2-ol.
| Compound Name | 2-[(2R,5R,6S)-5,9-dimethyl-1-oxaspiro[5.5]undec-9-en-2-yl]propan-2-ol |
|---|---|
| PubChem CID | 170990150 |
| Molecular Formula | C15H26O2 |
| Molecular Weight | 238.37 g/mol |
| Exact Mass | 238.19 |
| IUPAC Name | 2-[(2R,5R,6S)-5,9-dimethyl-1-oxaspiro[5.5]undec-9-en-2-yl]propan-2-ol |
| SMILES | CC1=CC[C@]2(CC1)O[C@@H](C(C)(C)O)CC[C@H]2C |
| InChI | InChI=1S/C15H26O2/c1-11-7-9-15(10-8-11)12(2)5-6-13(17-15)14(3,4)16/h7,12-13,16H,5-6,8-10H2,1-4H3/t12-,13-,15-/m1/s1 |
| InChIKey | UXRAVTFBHMHEIX-UMVBOHGHSA-N |
| XLogP | 3.44 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.37 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|