C16H22O4 — CID 170990188
(1S,4S,7S,10S,11R)-7-[(1E,3E,5E)-hepta-1,3,5-trienyl]-10-methyl-2,6,8-trioxatricyclo[5.3.1.04,11]undecan-4-ol (PubChem CID 170990188) has the molecular formula C16H22O4 and a molecular weight of 278.35 g/mol. Its IUPAC name is (1S,4S,7S,10S,11R)-7-[(1E,3E,5E)-hepta-1,3,5-trienyl]-10-methyl-2,6,8-trioxatricyclo[5.3.1.04,11]undecan-4-ol.
| Compound Name | (1S,4S,7S,10S,11R)-7-[(1E,3E,5E)-hepta-1,3,5-trienyl]-10-methyl-2,6,8-trioxatricyclo[5.3.1.04,11]undecan-4-ol |
|---|---|
| PubChem CID | 170990188 |
| Molecular Formula | C16H22O4 |
| Molecular Weight | 278.35 g/mol |
| Exact Mass | 278.15 |
| IUPAC Name | (1S,4S,7S,10S,11R)-7-[(1E,3E,5E)-hepta-1,3,5-trienyl]-10-methyl-2,6,8-trioxatricyclo[5.3.1.04,11]undecan-4-ol |
| SMILES | C/C=C/C=C/C=C/[C@]12OC[C@H](C)[C@@H]3OC[C@](O)(CO1)[C@@H]32 |
| InChI | InChI=1S/C16H22O4/c1-3-4-5-6-7-8-16-14-13(12(2)9-19-16)18-10-15(14,17)11-20-16/h3-8,12-14,17H,9-11H2,1-2H3/b4-3+,6-5+,8-7+/t12-,13-,14+,15-,16-/m0/s1 |
| InChIKey | ULKBZYCWYBXPQZ-GIIBARPTSA-N |
| XLogP | 1.81 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.35 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|