C17H24O4 — CID 170990191
(1R,4R,7R,10S,11S)-10-ethyl-7-hepta-1,3,5-trienyl-2,6,8-trioxatricyclo[5.3.1.04,11]undecan-4-ol (PubChem CID 170990191) has the molecular formula C17H24O4 and a molecular weight of 292.37 g/mol. Its IUPAC name is (1R,4R,7R,10S,11S)-10-ethyl-7-hepta-1,3,5-trienyl-2,6,8-trioxatricyclo[5.3.1.04,11]undecan-4-ol.
| Compound Name | (1R,4R,7R,10S,11S)-10-ethyl-7-hepta-1,3,5-trienyl-2,6,8-trioxatricyclo[5.3.1.04,11]undecan-4-ol |
|---|---|
| PubChem CID | 170990191 |
| Molecular Formula | C17H24O4 |
| Molecular Weight | 292.37 g/mol |
| Exact Mass | 292.17 |
| IUPAC Name | (1R,4R,7R,10S,11S)-10-ethyl-7-hepta-1,3,5-trienyl-2,6,8-trioxatricyclo[5.3.1.04,11]undecan-4-ol |
| SMILES | CC=CC=CC=C[C@@]12OC[C@H](CC)[C@H]3OC[C@@](O)(CO1)[C@H]32 |
| InChI | InChI=1S/C17H24O4/c1-3-5-6-7-8-9-17-15-14(13(4-2)10-20-17)19-11-16(15,18)12-21-17/h3,5-9,13-15,18H,4,10-12H2,1-2H3/t13-,14+,15-,16+,17+/m0/s1 |
| InChIKey | MWRUBDZTDYBYFR-DMRKSPOLSA-N |
| XLogP | 2.20 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.37 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|