C15H18O4 — CID 170990231
(6R,9S,9aR)-6-hydroxy-3-(hydroxymethyl)-9,9a-dimethyl-6,7,8,9-tetrahydrobenzo[g][1]benzofuran-4-one (PubChem CID 170990231) has the molecular formula C15H18O4 and a molecular weight of 262.31 g/mol. Its IUPAC name is (6R,9S,9aR)-6-hydroxy-3-(hydroxymethyl)-9,9a-dimethyl-6,7,8,9-tetrahydrobenzo[g][1]benzofuran-4-one.
| Compound Name | (6R,9S,9aR)-6-hydroxy-3-(hydroxymethyl)-9,9a-dimethyl-6,7,8,9-tetrahydrobenzo[g][1]benzofuran-4-one |
|---|---|
| PubChem CID | 170990231 |
| Molecular Formula | C15H18O4 |
| Molecular Weight | 262.31 g/mol |
| Exact Mass | 262.12 |
| IUPAC Name | (6R,9S,9aR)-6-hydroxy-3-(hydroxymethyl)-9,9a-dimethyl-6,7,8,9-tetrahydrobenzo[g][1]benzofuran-4-one |
| SMILES | C[C@H]1CC[C@@H](O)C2=CC(=O)c3c(CO)coc3[C@@]21C |
| InChI | InChI=1S/C15H18O4/c1-8-3-4-11(17)10-5-12(18)13-9(6-16)7-19-14(13)15(8,10)2/h5,7-8,11,16-17H,3-4,6H2,1-2H3/t8-,11+,15+/m0/s1 |
| InChIKey | XGPWNTTUSBBONN-IYYOCNSZSA-N |
| XLogP | 1.94 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.31 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |