C21H26O6 — CID 170990251
(1S,5R,8R)-1-ethyl-8-[(3E,5E)-7-hydroxy-2-oxohepta-3,5-dienyl]-3,5-dimethyl-2-(2-oxopropyl)-6-oxabicyclo[3.2.1]oct-2-ene-4,7-dione (PubChem CID 170990251) has the molecular formula C21H26O6 and a molecular weight of 374.43 g/mol. Its IUPAC name is (1S,5R,8R)-1-ethyl-8-[(3E,5E)-7-hydroxy-2-oxohepta-3,5-dienyl]-3,5-dimethyl-2-(2-oxopropyl)-6-oxabicyclo[3.2.1]oct-2-ene-4,7-dione.
| Compound Name | (1S,5R,8R)-1-ethyl-8-[(3E,5E)-7-hydroxy-2-oxohepta-3,5-dienyl]-3,5-dimethyl-2-(2-oxopropyl)-6-oxabicyclo[3.2.1]oct-2-ene-4,7-dione |
|---|---|
| PubChem CID | 170990251 |
| Molecular Formula | C21H26O6 |
| Molecular Weight | 374.43 g/mol |
| Exact Mass | 374.17 |
| IUPAC Name | (1S,5R,8R)-1-ethyl-8-[(3E,5E)-7-hydroxy-2-oxohepta-3,5-dienyl]-3,5-dimethyl-2-(2-oxopropyl)-6-oxabicyclo[3.2.1]oct-2-ene-4,7-dione |
| SMILES | CC[C@@]12C(=O)O[C@@](C)(C(=O)C(C)=C1CC(C)=O)[C@@H]2CC(=O)/C=C/C=C/CO |
| InChI | InChI=1S/C21H26O6/c1-5-21-16(11-13(2)23)14(3)18(25)20(4,27-19(21)26)17(21)12-15(24)9-7-6-8-10-22/h6-9,17,22H,5,10-12H2,1-4H3/b8-6+,9-7+/t17-,20+,21+/m0/s1 |
| InChIKey | QMXGDZRBVXYFRX-YNEOTWCISA-N |
| XLogP | 2.26 |
| TPSA | 97.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.43 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|