C22H32O4 — CID 170990252
(1S,5R,8R)-1-ethyl-8-[(2R,3E,5E)-2-hydroxyhepta-3,5-dienyl]-3,5-dimethyl-2-(2-methylpropyl)-6-oxabicyclo[3.2.1]oct-2-ene-4,7-dione (PubChem CID 170990252) has the molecular formula C22H32O4 and a molecular weight of 360.49 g/mol. Its IUPAC name is (1S,5R,8R)-1-ethyl-8-[(2R,3E,5E)-2-hydroxyhepta-3,5-dienyl]-3,5-dimethyl-2-(2-methylpropyl)-6-oxabicyclo[3.2.1]oct-2-ene-4,7-dione.
| Compound Name | (1S,5R,8R)-1-ethyl-8-[(2R,3E,5E)-2-hydroxyhepta-3,5-dienyl]-3,5-dimethyl-2-(2-methylpropyl)-6-oxabicyclo[3.2.1]oct-2-ene-4,7-dione |
|---|---|
| PubChem CID | 170990252 |
| Molecular Formula | C22H32O4 |
| Molecular Weight | 360.49 g/mol |
| Exact Mass | 360.23 |
| IUPAC Name | (1S,5R,8R)-1-ethyl-8-[(2R,3E,5E)-2-hydroxyhepta-3,5-dienyl]-3,5-dimethyl-2-(2-methylpropyl)-6-oxabicyclo[3.2.1]oct-2-ene-4,7-dione |
| SMILES | C/C=C/C=C/[C@H](O)C[C@@H]1[C@]2(CC)C(=O)O[C@@]1(C)C(=O)C(C)=C2CC(C)C |
| InChI | InChI=1S/C22H32O4/c1-7-9-10-11-16(23)13-18-21(6)19(24)15(5)17(12-14(3)4)22(18,8-2)20(25)26-21/h7,9-11,14,16,18,23H,8,12-13H2,1-6H3/b9-7+,11-10+/t16-,18-,21+,22+/m0/s1 |
| InChIKey | UFAIGEWDPRHSLP-MLCNSPPHSA-N |
| XLogP | 4.14 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.49 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|