C20H27NO2 — CID 170990270
1-hexadeca-2,4,8,10,14-pentaenoylpyrrolidin-2-one (PubChem CID 170990270) has the molecular formula C20H27NO2 and a molecular weight of 313.44 g/mol. Its IUPAC name is 1-hexadeca-2,4,8,10,14-pentaenoylpyrrolidin-2-one.
| Compound Name | 1-hexadeca-2,4,8,10,14-pentaenoylpyrrolidin-2-one |
|---|---|
| PubChem CID | 170990270 |
| Molecular Formula | C20H27NO2 |
| Molecular Weight | 313.44 g/mol |
| Exact Mass | 313.20 |
| IUPAC Name | 1-hexadeca-2,4,8,10,14-pentaenoylpyrrolidin-2-one |
| SMILES | CC=CCCC=CC=CCCC=CC=CC(=O)N1CCCC1=O |
| InChI | InChI=1S/C20H27NO2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-16-19(22)21-18-15-17-20(21)23/h2-3,6-9,12-14,16H,4-5,10-11,15,17-18H2,1H3 |
| InChIKey | JNDGMGJELQHSRP-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.44 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|