C27H23N3O8 — CID 170990325
[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl] 1-(1H-indole-3-carbonyl)-9H-pyrido[3,4-b]indole-3-carboxylate (PubChem CID 170990325) has the molecular formula C27H23N3O8 and a molecular weight of 517.49 g/mol. Its IUPAC name is [(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl] 1-(1H-indole-3-carbonyl)-9H-pyrido[3,4-b]indole-3-carboxylate.
| Compound Name | [(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl] 1-(1H-indole-3-carbonyl)-9H-pyrido[3,4-b]indole-3-carboxylate |
|---|---|
| PubChem CID | 170990325 |
| Molecular Formula | C27H23N3O8 |
| Molecular Weight | 517.49 g/mol |
| Exact Mass | 517.15 |
| IUPAC Name | [(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl] 1-(1H-indole-3-carbonyl)-9H-pyrido[3,4-b]indole-3-carboxylate |
| SMILES | O=C(O[C@@H]1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O)c1cc2c([nH]c3ccccc32)c(C(=O)c2c[nH]c3ccccc23)n1 |
| InChI | InChI=1S/C27H23N3O8/c31-11-19-23(33)24(34)25(35)27(37-19)38-26(36)18-9-14-12-5-2-4-8-17(12)29-20(14)21(30-18)22(32)15-10-28-16-7-3-1-6-13(15)16/h1-10,19,23-25,27-29,31,33-35H,11H2/t19-,23-,24+,25-,27+/m1/s1 |
| InChIKey | BXPFANMWDXBDBC-USLKBVJRSA-N |
| XLogP | 1.39 |
| TPSA | 177.99 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.49 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 9 |