About [(2S)-1-(4,7-dihydroxy-5-methoxy-9,10-dioxoanthracen-2-yl)propan-2-yl] acetate
[(2S)-1-(4,7-dihydroxy-5-methoxy-9,10-dioxoanthracen-2-yl)propan-2-yl] acetate (PubChem CID 170990389) has the molecular formula C20H18O7
and a molecular weight of 370.36 g/mol. Its IUPAC name is [(2S)-1-(4,7-dihydroxy-5-methoxy-9,10-dioxoanthracen-2-yl)propan-2-yl] acetate.
Molecular Properties
| Compound Name | [(2S)-1-(4,7-dihydroxy-5-methoxy-9,10-dioxoanthracen-2-yl)propan-2-yl] acetate |
| PubChem CID | 170990389 |
| Molecular Formula | C20H18O7 |
| Molecular Weight | 370.36 g/mol |
| Exact Mass | 370.11 |
| IUPAC Name | [(2S)-1-(4,7-dihydroxy-5-methoxy-9,10-dioxoanthracen-2-yl)propan-2-yl] acetate |
| SMILES | COc1cc(O)cc2c1C(=O)c1c(O)cc(C[C@H](C)OC(C)=O)cc1C2=O |
| InChI | InChI=1S/C20H18O7/c1-9(27-10(2)21)4-11-5-13-17(15(23)6-11)20(25)18-14(19(13)24)7-12(22)8-16(18)26-3/h5-9,22-23H,4H2,1-3H3/t9-/m0/s1 |
| InChIKey | NLRYWTJBYCUIOK-VIFPVBQESA-N |
| XLogP | 2.38 |
| TPSA | 110.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 370.36 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|
Analyze [(2S)-1-(4,7-dihydroxy-5-methoxy-9,10-dioxoanthracen-2-yl)propan-2-yl] acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(2S)-1-(4,7-dihydroxy-5-methoxy-9,10-dioxoanthracen-2-yl)propan-2-yl] acetate?
The IUPAC name of [(2S)-1-(4,7-dihydroxy-5-methoxy-9,10-dioxoanthracen-2-yl)propan-2-yl] acetate (CID 170990389) is [(2S)-1-(4,7-dihydroxy-5-methoxy-9,10-dioxoanthracen-2-yl)propan-2-yl] acetate.
What is the SMILES notation for [(2S)-1-(4,7-dihydroxy-5-methoxy-9,10-dioxoanthracen-2-yl)propan-2-yl] acetate?
The canonical SMILES for [(2S)-1-(4,7-dihydroxy-5-methoxy-9,10-dioxoanthracen-2-yl)propan-2-yl] acetate is COc1cc(O)cc2c1C(=O)c1c(O)cc(C[C@H](C)OC(C)=O)cc1C2=O.
What is the InChIKey of [(2S)-1-(4,7-dihydroxy-5-methoxy-9,10-dioxoanthracen-2-yl)propan-2-yl] acetate?
The InChIKey is NLRYWTJBYCUIOK-VIFPVBQESA-N. The full InChI is InChI=1S/C20H18O7/c1-9(27-10(2)21)4-11-5-13-17(15(23)6-11)20(25)18-14(19(13)24)7-12(22)8-16(18)26-3/h5-9,22-23H,4H2,1-3H3/t9-/m0/s1.
What are the key properties of [(2S)-1-(4,7-dihydroxy-5-methoxy-9,10-dioxoanthracen-2-yl)propan-2-yl] acetate?
[(2S)-1-(4,7-dihydroxy-5-methoxy-9,10-dioxoanthracen-2-yl)propan-2-yl] acetate has a molecular weight of 370.36 g/mol, XLogP of 2.38, 4 rotatable bonds, 2 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for [(2S)-1-(4,7-dihydroxy-5-methoxy-9,10-dioxoanthracen-2-yl)propan-2-yl] acetate is sourced from PubChem (CID 170990389), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).