About (4S,5S)-4-acetyl-4,5-dihydroxy-3-methoxy-5-methylcyclopent-2-en-1-one
(4S,5S)-4-acetyl-4,5-dihydroxy-3-methoxy-5-methylcyclopent-2-en-1-one (PubChem CID 170990393) has the molecular formula C9H12O5
and a molecular weight of 200.19 g/mol. Its IUPAC name is (4S,5S)-4-acetyl-4,5-dihydroxy-3-methoxy-5-methylcyclopent-2-en-1-one.
Molecular Properties
| Compound Name | (4S,5S)-4-acetyl-4,5-dihydroxy-3-methoxy-5-methylcyclopent-2-en-1-one |
| PubChem CID | 170990393 |
| Molecular Formula | C9H12O5 |
| Molecular Weight | 200.19 g/mol |
| Exact Mass | 200.07 |
| IUPAC Name | (4S,5S)-4-acetyl-4,5-dihydroxy-3-methoxy-5-methylcyclopent-2-en-1-one |
| SMILES | COC1=CC(=O)[C@@](C)(O)[C@@]1(O)C(C)=O |
| InChI | InChI=1S/C9H12O5/c1-5(10)9(13)7(14-3)4-6(11)8(9,2)12/h4,12-13H,1-3H3/t8-,9-/m1/s1 |
| InChIKey | BLVIHWFDGFECBZ-RKDXNWHRSA-N |
| XLogP | -0.83 |
| TPSA | 83.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 200.19 |
| LogP ≤ 5 | -0.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze (4S,5S)-4-acetyl-4,5-dihydroxy-3-methoxy-5-methylcyclopent-2-en-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4S,5S)-4-acetyl-4,5-dihydroxy-3-methoxy-5-methylcyclopent-2-en-1-one?
The IUPAC name of (4S,5S)-4-acetyl-4,5-dihydroxy-3-methoxy-5-methylcyclopent-2-en-1-one (CID 170990393) is (4S,5S)-4-acetyl-4,5-dihydroxy-3-methoxy-5-methylcyclopent-2-en-1-one.
What is the SMILES notation for (4S,5S)-4-acetyl-4,5-dihydroxy-3-methoxy-5-methylcyclopent-2-en-1-one?
The canonical SMILES for (4S,5S)-4-acetyl-4,5-dihydroxy-3-methoxy-5-methylcyclopent-2-en-1-one is COC1=CC(=O)[C@@](C)(O)[C@@]1(O)C(C)=O.
What is the InChIKey of (4S,5S)-4-acetyl-4,5-dihydroxy-3-methoxy-5-methylcyclopent-2-en-1-one?
The InChIKey is BLVIHWFDGFECBZ-RKDXNWHRSA-N. The full InChI is InChI=1S/C9H12O5/c1-5(10)9(13)7(14-3)4-6(11)8(9,2)12/h4,12-13H,1-3H3/t8-,9-/m1/s1.
What are the key properties of (4S,5S)-4-acetyl-4,5-dihydroxy-3-methoxy-5-methylcyclopent-2-en-1-one?
(4S,5S)-4-acetyl-4,5-dihydroxy-3-methoxy-5-methylcyclopent-2-en-1-one has a molecular weight of 200.19 g/mol, XLogP of -0.83, 2 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (4S,5S)-4-acetyl-4,5-dihydroxy-3-methoxy-5-methylcyclopent-2-en-1-one is sourced from PubChem (CID 170990393), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).