C28H39NO3 — CID 170990398
3-[(2S,5R,6R)-6-[(E,4R,6S)-4,6-dimethyloct-2-en-2-yl]-5-methyloxan-2-yl]-4-hydroxy-1-methyl-5-phenylpyridin-2-one (PubChem CID 170990398) has the molecular formula C28H39NO3 and a molecular weight of 437.62 g/mol. Its IUPAC name is 3-[(2S,5R,6R)-6-[(E,4R,6S)-4,6-dimethyloct-2-en-2-yl]-5-methyloxan-2-yl]-4-hydroxy-1-methyl-5-phenylpyridin-2-one.
| Compound Name | 3-[(2S,5R,6R)-6-[(E,4R,6S)-4,6-dimethyloct-2-en-2-yl]-5-methyloxan-2-yl]-4-hydroxy-1-methyl-5-phenylpyridin-2-one |
|---|---|
| PubChem CID | 170990398 |
| Molecular Formula | C28H39NO3 |
| Molecular Weight | 437.62 g/mol |
| Exact Mass | 437.29 |
| IUPAC Name | 3-[(2S,5R,6R)-6-[(E,4R,6S)-4,6-dimethyloct-2-en-2-yl]-5-methyloxan-2-yl]-4-hydroxy-1-methyl-5-phenylpyridin-2-one |
| SMILES | CC[C@H](C)C[C@@H](C)/C=C(\C)[C@@H]1O[C@H](c2c(O)c(-c3ccccc3)cn(C)c2=O)CC[C@H]1C |
| InChI | InChI=1S/C28H39NO3/c1-7-18(2)15-19(3)16-21(5)27-20(4)13-14-24(32-27)25-26(30)23(17-29(6)28(25)31)22-11-9-8-10-12-22/h8-12,16-20,24,27,30H,7,13-15H2,1-6H3/b21-16+/t18-,19+,20+,24-,27+/m0/s1 |
| InChIKey | KGZHTWWTXXVXHP-FIPJRBQWSA-N |
| XLogP | 6.63 |
| TPSA | 51.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.62 |
| LogP ≤ 5 | 6.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|