C21H29ClO7 — CID 170990409
[(7R,8R,8aS)-5-chloro-3-[(3S,4R,5S)-3,4-dihydroxy-3,5-dimethylhept-1-enyl]-7-hydroxy-7-methyl-6-oxo-8,8a-dihydro-1H-isochromen-8-yl] acetate (PubChem CID 170990409) has the molecular formula C21H29ClO7 and a molecular weight of 428.91 g/mol. Its IUPAC name is [(7R,8R,8aS)-5-chloro-3-[(3S,4R,5S)-3,4-dihydroxy-3,5-dimethylhept-1-enyl]-7-hydroxy-7-methyl-6-oxo-8,8a-dihydro-1H-isochromen-8-yl] acetate.
| Compound Name | [(7R,8R,8aS)-5-chloro-3-[(3S,4R,5S)-3,4-dihydroxy-3,5-dimethylhept-1-enyl]-7-hydroxy-7-methyl-6-oxo-8,8a-dihydro-1H-isochromen-8-yl] acetate |
|---|---|
| PubChem CID | 170990409 |
| Molecular Formula | C21H29ClO7 |
| Molecular Weight | 428.91 g/mol |
| Exact Mass | 428.16 |
| IUPAC Name | [(7R,8R,8aS)-5-chloro-3-[(3S,4R,5S)-3,4-dihydroxy-3,5-dimethylhept-1-enyl]-7-hydroxy-7-methyl-6-oxo-8,8a-dihydro-1H-isochromen-8-yl] acetate |
| SMILES | CC[C@H](C)[C@@H](O)[C@@](C)(O)C=CC1=CC2=C(Cl)C(=O)[C@](C)(O)[C@H](OC(C)=O)[C@@H]2CO1 |
| InChI | InChI=1S/C21H29ClO7/c1-6-11(2)17(24)20(4,26)8-7-13-9-14-15(10-28-13)19(29-12(3)23)21(5,27)18(25)16(14)22/h7-9,11,15,17,19,24,26-27H,6,10H2,1-5H3/t11-,15+,17+,19+,20-,21-/m0/s1 |
| InChIKey | BPFKUKMOOOUEPT-HUBDVXQZSA-N |
| XLogP | 1.99 |
| TPSA | 113.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.91 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_one_hal(17)', 'substructure': 'N/A'} |
|---|