About (-)-euroticin I
(-)-euroticin I (PubChem CID 170990416) has the molecular formula C17H28O3
and a molecular weight of 280.40 g/mol. Its IUPAC name is (5S)-5-heptyl-5-hydroxy-3-(3-hydroxy-3-methylbut-1-enyl)cyclopent-2-en-1-one.
Molecular Properties
| Compound Name | (-)-euroticin I |
| PubChem CID | 170990416 |
| Molecular Formula | C17H28O3 |
| Molecular Weight | 280.40 g/mol |
| Exact Mass | 280.20 |
| IUPAC Name | (5S)-5-heptyl-5-hydroxy-3-(3-hydroxy-3-methylbut-1-enyl)cyclopent-2-en-1-one |
| SMILES | CCCCCCC[C@@]1(CC(=CC1=O)C=CC(C)(C)O)O |
| InChI | InChI=1S/C17H28O3/c1-4-5-6-7-8-10-17(20)13-14(12-15(17)18)9-11-16(2,3)19/h9,11-12,19-20H,4-8,10,13H2,1-3H3/t17-/m0/s1 |
| InChIKey | AFZOPUOXGZWJOY-KRWDZBQOSA-N |
| XLogP | 3.10 |
| TPSA | 57.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | 393 |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 280.40 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze (-)-euroticin I with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (-)-euroticin I?
The IUPAC name of (-)-euroticin I (CID 170990416) is (5S)-5-heptyl-5-hydroxy-3-(3-hydroxy-3-methylbut-1-enyl)cyclopent-2-en-1-one.
What is the SMILES notation for (-)-euroticin I?
The canonical SMILES for (-)-euroticin I is CCCCCCC[C@@]1(CC(=CC1=O)C=CC(C)(C)O)O.
What is the InChIKey of (-)-euroticin I?
The InChIKey is AFZOPUOXGZWJOY-KRWDZBQOSA-N. The full InChI is InChI=1S/C17H28O3/c1-4-5-6-7-8-10-17(20)13-14(12-15(17)18)9-11-16(2,3)19/h9,11-12,19-20H,4-8,10,13H2,1-3H3/t17-/m0/s1.
What are the key properties of (-)-euroticin I?
(-)-euroticin I has a molecular weight of 280.40 g/mol, XLogP of 3.10, 8 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (-)-euroticin I is sourced from PubChem (CID 170990416), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).