C17H24O4 — CID 170990483
4-hydroxy-6-[(2R,7S)-2-hydroxy-5,7-dimethylnona-3,5-dienyl]-3-methylpyran-2-one (PubChem CID 170990483) has the molecular formula C17H24O4 and a molecular weight of 292.38 g/mol. Its IUPAC name is 4-hydroxy-6-[(2R,7S)-2-hydroxy-5,7-dimethylnona-3,5-dienyl]-3-methylpyran-2-one.
| Compound Name | 4-hydroxy-6-[(2R,7S)-2-hydroxy-5,7-dimethylnona-3,5-dienyl]-3-methylpyran-2-one |
|---|---|
| PubChem CID | 170990483 |
| Molecular Formula | C17H24O4 |
| Molecular Weight | 292.38 g/mol |
| Exact Mass | 292.17 |
| IUPAC Name | 4-hydroxy-6-[(2R,7S)-2-hydroxy-5,7-dimethylnona-3,5-dienyl]-3-methylpyran-2-one |
| SMILES | CC[C@H](C)C=C(C)C=C[C@H](O)Cc1cc(O)c(C)c(=O)o1 |
| InChI | InChI=1S/C17H24O4/c1-5-11(2)8-12(3)6-7-14(18)9-15-10-16(19)13(4)17(20)21-15/h6-8,10-11,14,18-19H,5,9H2,1-4H3/t11-,14-/m0/s1 |
| InChIKey | CDGZDKQDULYHMO-FZMZJTMJSA-N |
| XLogP | 3.11 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.38 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|