C13H22O3 — CID 170990520
(4S,5R,6R)-6-[(E)-but-2-en-2-yl]-4-methoxy-3,3,5-trimethyloxan-2-one (PubChem CID 170990520) has the molecular formula C13H22O3 and a molecular weight of 226.32 g/mol. Its IUPAC name is (4S,5R,6R)-6-[(E)-but-2-en-2-yl]-4-methoxy-3,3,5-trimethyloxan-2-one.
| Compound Name | (4S,5R,6R)-6-[(E)-but-2-en-2-yl]-4-methoxy-3,3,5-trimethyloxan-2-one |
|---|---|
| PubChem CID | 170990520 |
| Molecular Formula | C13H22O3 |
| Molecular Weight | 226.32 g/mol |
| Exact Mass | 226.16 |
| IUPAC Name | (4S,5R,6R)-6-[(E)-but-2-en-2-yl]-4-methoxy-3,3,5-trimethyloxan-2-one |
| SMILES | C/C=C(\C)[C@@H]1OC(=O)C(C)(C)[C@@H](OC)[C@H]1C |
| InChI | InChI=1S/C13H22O3/c1-7-8(2)10-9(3)11(15-6)13(4,5)12(14)16-10/h7,9-11H,1-6H3/b8-7+/t9-,10-,11-/m0/s1 |
| InChIKey | VLNNPFJBEPGLFW-ZYUZMEKTSA-N |
| XLogP | 2.56 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.32 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|