C11H18O5 — CID 170990649
(4R,5R,6S)-6-butoxy-4,5-dihydroxy-2-(hydroxymethyl)cyclohex-2-en-1-one (PubChem CID 170990649) has the molecular formula C11H18O5 and a molecular weight of 230.26 g/mol. Its IUPAC name is (4R,5R,6S)-6-butoxy-4,5-dihydroxy-2-(hydroxymethyl)cyclohex-2-en-1-one.
| Compound Name | (4R,5R,6S)-6-butoxy-4,5-dihydroxy-2-(hydroxymethyl)cyclohex-2-en-1-one |
|---|---|
| PubChem CID | 170990649 |
| Molecular Formula | C11H18O5 |
| Molecular Weight | 230.26 g/mol |
| Exact Mass | 230.12 |
| IUPAC Name | (4R,5R,6S)-6-butoxy-4,5-dihydroxy-2-(hydroxymethyl)cyclohex-2-en-1-one |
| SMILES | CCCCO[C@@H]1C(=O)C(CO)=C[C@@H](O)[C@H]1O |
| InChI | InChI=1S/C11H18O5/c1-2-3-4-16-11-9(14)7(6-12)5-8(13)10(11)15/h5,8,10-13,15H,2-4,6H2,1H3/t8-,10-,11-/m1/s1 |
| InChIKey | ILMKCERWTRXZPO-FBIMIBRVSA-N |
| XLogP | -0.61 |
| TPSA | 86.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.26 |
| LogP ≤ 5 | -0.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|