About (2S)-2-propan-2-yl-1,2-dihydropyrrol-5-one
(2S)-2-propan-2-yl-1,2-dihydropyrrol-5-one (PubChem CID 170990666) has the molecular formula C7H11NO
and a molecular weight of 125.17 g/mol. Its IUPAC name is (2S)-2-propan-2-yl-1,2-dihydropyrrol-5-one.
Molecular Properties
| Compound Name | (2S)-2-propan-2-yl-1,2-dihydropyrrol-5-one |
| PubChem CID | 170990666 |
| Molecular Formula | C7H11NO |
| Molecular Weight | 125.17 g/mol |
| Exact Mass | 125.08 |
| IUPAC Name | (2S)-2-propan-2-yl-1,2-dihydropyrrol-5-one |
| SMILES | CC(C)[C@H]1C=CC(=O)N1 |
| InChI | InChI=1S/C7H11NO/c1-5(2)6-3-4-7(9)8-6/h3-6H,1-2H3,(H,8,9)/t6-/m1/s1 |
| InChIKey | MZRQFMIUXUHLKK-ZCFIWIBFSA-N |
| XLogP | 0.70 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 125.17 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze (2S)-2-propan-2-yl-1,2-dihydropyrrol-5-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S)-2-propan-2-yl-1,2-dihydropyrrol-5-one?
The IUPAC name of (2S)-2-propan-2-yl-1,2-dihydropyrrol-5-one (CID 170990666) is (2S)-2-propan-2-yl-1,2-dihydropyrrol-5-one.
What is the SMILES notation for (2S)-2-propan-2-yl-1,2-dihydropyrrol-5-one?
The canonical SMILES for (2S)-2-propan-2-yl-1,2-dihydropyrrol-5-one is CC(C)[C@H]1C=CC(=O)N1.
What is the InChIKey of (2S)-2-propan-2-yl-1,2-dihydropyrrol-5-one?
The InChIKey is MZRQFMIUXUHLKK-ZCFIWIBFSA-N. The full InChI is InChI=1S/C7H11NO/c1-5(2)6-3-4-7(9)8-6/h3-6H,1-2H3,(H,8,9)/t6-/m1/s1.
What are the key properties of (2S)-2-propan-2-yl-1,2-dihydropyrrol-5-one?
(2S)-2-propan-2-yl-1,2-dihydropyrrol-5-one has a molecular weight of 125.17 g/mol, XLogP of 0.70, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (2S)-2-propan-2-yl-1,2-dihydropyrrol-5-one is sourced from PubChem (CID 170990666), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).