C9H16O5 — CID 170990688
(2S,6R)-2,4,4-trimethoxy-6-methyloxan-3-one (PubChem CID 170990688) has the molecular formula C9H16O5 and a molecular weight of 204.22 g/mol. Its IUPAC name is (2S,6R)-2,4,4-trimethoxy-6-methyloxan-3-one.
| Compound Name | (2S,6R)-2,4,4-trimethoxy-6-methyloxan-3-one |
|---|---|
| PubChem CID | 170990688 |
| Molecular Formula | C9H16O5 |
| Molecular Weight | 204.22 g/mol |
| Exact Mass | 204.10 |
| IUPAC Name | (2S,6R)-2,4,4-trimethoxy-6-methyloxan-3-one |
| SMILES | CO[C@H]1O[C@H](C)CC(OC)(OC)C1=O |
| InChI | InChI=1S/C9H16O5/c1-6-5-9(12-3,13-4)7(10)8(11-2)14-6/h6,8H,5H2,1-4H3/t6-,8+/m1/s1 |
| InChIKey | GGTXJKCBXPGDSA-SVRRBLITSA-N |
| XLogP | 0.33 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.22 |
| LogP ≤ 5 | 0.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|