C31H41NO6 — CID 170990743
(1S,4E,10R,12E,14S,15S,17S,18S,19S)-19-benzyl-15-hydroxy-6,6-dimethoxy-10,17-dimethyl-16-methylidene-2-oxa-20-azatricyclo[12.7.0.01,18]henicosa-4,12-diene-3,21-dione (PubChem CID 170990743) has the molecular formula C31H41NO6 and a molecular weight of 523.67 g/mol. Its IUPAC name is (1S,4E,10R,12E,14S,15S,17S,18S,19S)-19-benzyl-15-hydroxy-6,6-dimethoxy-10,17-dimethyl-16-methylidene-2-oxa-20-azatricyclo[12.7.0.01,18]henicosa-4,12-diene-3,21-dione.
| Compound Name | (1S,4E,10R,12E,14S,15S,17S,18S,19S)-19-benzyl-15-hydroxy-6,6-dimethoxy-10,17-dimethyl-16-methylidene-2-oxa-20-azatricyclo[12.7.0.01,18]henicosa-4,12-diene-3,21-dione |
|---|---|
| PubChem CID | 170990743 |
| Molecular Formula | C31H41NO6 |
| Molecular Weight | 523.67 g/mol |
| Exact Mass | 523.29 |
| IUPAC Name | (1S,4E,10R,12E,14S,15S,17S,18S,19S)-19-benzyl-15-hydroxy-6,6-dimethoxy-10,17-dimethyl-16-methylidene-2-oxa-20-azatricyclo[12.7.0.01,18]henicosa-4,12-diene-3,21-dione |
| SMILES | C=C1[C@@H](C)[C@H]2[C@H](Cc3ccccc3)NC(=O)[C@]23OC(=O)/C=C/C(OC)(OC)CCC[C@@H](C)C/C=C/[C@H]3[C@@H]1O |
| InChI | InChI=1S/C31H41NO6/c1-20-11-9-15-24-28(34)22(3)21(2)27-25(19-23-13-7-6-8-14-23)32-29(35)31(24,27)38-26(33)16-18-30(36-4,37-5)17-10-12-20/h6-9,13-16,18,20-21,24-25,27-28,34H,3,10-12,17,19H2,1-2,4-5H3,(H,32,35)/b15-9+,18-16+/t20-,21+,24-,25-,27-,28+,31+/m0/s1 |
| InChIKey | DOPNODIYSJBEIT-XPWPYBABSA-N |
| XLogP | 4.12 |
| TPSA | 94.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.67 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|