C14H20O3 — CID 170990774
(1R,3S,7S,9aR)-1,3-dihydroxy-7,9a-dimethyl-1,2,3,7,8,9-hexahydrobenzo[7]annulene-6-carbaldehyde (PubChem CID 170990774) has the molecular formula C14H20O3 and a molecular weight of 236.31 g/mol. Its IUPAC name is (1R,3S,7S,9aR)-1,3-dihydroxy-7,9a-dimethyl-1,2,3,7,8,9-hexahydrobenzo[7]annulene-6-carbaldehyde.
| Compound Name | (1R,3S,7S,9aR)-1,3-dihydroxy-7,9a-dimethyl-1,2,3,7,8,9-hexahydrobenzo[7]annulene-6-carbaldehyde |
|---|---|
| PubChem CID | 170990774 |
| Molecular Formula | C14H20O3 |
| Molecular Weight | 236.31 g/mol |
| Exact Mass | 236.14 |
| IUPAC Name | (1R,3S,7S,9aR)-1,3-dihydroxy-7,9a-dimethyl-1,2,3,7,8,9-hexahydrobenzo[7]annulene-6-carbaldehyde |
| SMILES | C[C@H]1CC[C@]2(C)C(=C[C@@H](O)C[C@H]2O)C=C1C=O |
| InChI | InChI=1S/C14H20O3/c1-9-3-4-14(2)11(5-10(9)8-15)6-12(16)7-13(14)17/h5-6,8-9,12-13,16-17H,3-4,7H2,1-2H3/t9-,12+,13+,14+/m0/s1 |
| InChIKey | FYXJLOUJPYEVAL-KQURDKLPSA-N |
| XLogP | 1.60 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.31 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|