C22H28O5 — CID 170990802
(3S,3aR,9aR)-3-hexanoyl-3a,9a-dimethyl-6-[(Z)-prop-1-enyl]-4,8-dihydro-3H-furo[3,2-g]isochromene-2,9-dione (PubChem CID 170990802) has the molecular formula C22H28O5 and a molecular weight of 372.46 g/mol. Its IUPAC name is (3S,3aR,9aR)-3-hexanoyl-3a,9a-dimethyl-6-[(Z)-prop-1-enyl]-4,8-dihydro-3H-furo[3,2-g]isochromene-2,9-dione.
| Compound Name | (3S,3aR,9aR)-3-hexanoyl-3a,9a-dimethyl-6-[(Z)-prop-1-enyl]-4,8-dihydro-3H-furo[3,2-g]isochromene-2,9-dione |
|---|---|
| PubChem CID | 170990802 |
| Molecular Formula | C22H28O5 |
| Molecular Weight | 372.46 g/mol |
| Exact Mass | 372.19 |
| IUPAC Name | (3S,3aR,9aR)-3-hexanoyl-3a,9a-dimethyl-6-[(Z)-prop-1-enyl]-4,8-dihydro-3H-furo[3,2-g]isochromene-2,9-dione |
| SMILES | C/C=C\C1=CC2=C(CO1)C(=O)[C@]1(C)OC(=O)[C@H](C(=O)CCCCC)[C@@]1(C)C2 |
| InChI | InChI=1S/C22H28O5/c1-5-7-8-10-17(23)18-20(25)27-22(4)19(24)16-13-26-15(9-6-2)11-14(16)12-21(18,22)3/h6,9,11,18H,5,7-8,10,12-13H2,1-4H3/b9-6-/t18-,21+,22-/m0/s1 |
| InChIKey | HITCYFHLRMERMC-HOLUQDPGSA-N |
| XLogP | 3.83 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.46 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|