C21H45N9 — CID 170990931
3-[3,5-bis[3-(dimethylamino)propyl]-1,3,5-triazinan-1-yl]-N,N-dimethylpropan-1-amine;1,3,5-triazine (PubChem CID 170990931) has the molecular formula C21H45N9 and a molecular weight of 423.65 g/mol. Its IUPAC name is 3-[3,5-bis[3-(dimethylamino)propyl]-1,3,5-triazinan-1-yl]-N,N-dimethylpropan-1-amine;1,3,5-triazine.
| Compound Name | 3-[3,5-bis[3-(dimethylamino)propyl]-1,3,5-triazinan-1-yl]-N,N-dimethylpropan-1-amine;1,3,5-triazine |
|---|---|
| PubChem CID | 170990931 |
| Molecular Formula | C21H45N9 |
| Molecular Weight | 423.65 g/mol |
| Exact Mass | 423.38 |
| IUPAC Name | 3-[3,5-bis[3-(dimethylamino)propyl]-1,3,5-triazinan-1-yl]-N,N-dimethylpropan-1-amine;1,3,5-triazine |
| SMILES | CN(C)CCCN1CN(CCCN(C)C)CN(CCCN(C)C)C1.c1ncncn1 |
| InChI | InChI=1S/C18H42N6.C3H3N3/c1-19(2)10-7-13-22-16-23(14-8-11-20(3)4)18-24(17-22)15-9-12-21(5)6;1-4-2-6-3-5-1/h7-18H2,1-6H3;1-3H |
| InChIKey | KCGBSOGJBJEURO-UHFFFAOYSA-N |
| XLogP | 0.51 |
| TPSA | 58.11 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.65 |
| LogP ≤ 5 | 0.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |