About 3-(4-chloro-7-hydroxyquinazolin-6-yl)-2,2-dimethylpropanoate
3-(4-chloro-7-hydroxyquinazolin-6-yl)-2,2-dimethylpropanoate (PubChem CID 170991129) has the molecular formula C13H12ClN2O3-
and a molecular weight of 279.70 g/mol. Its IUPAC name is 3-(4-chloro-7-hydroxyquinazolin-6-yl)-2,2-dimethylpropanoate.
Molecular Properties
| Compound Name | 3-(4-chloro-7-hydroxyquinazolin-6-yl)-2,2-dimethylpropanoate |
| PubChem CID | 170991129 |
| Molecular Formula | C13H12ClN2O3- |
| Molecular Weight | 279.70 g/mol |
| Exact Mass | 279.05 |
| IUPAC Name | 3-(4-chloro-7-hydroxyquinazolin-6-yl)-2,2-dimethylpropanoate |
| SMILES | CC(C)(Cc1cc2c(Cl)ncnc2cc1O)C(=O)[O-] |
| InChI | InChI=1S/C13H13ClN2O3/c1-13(2,12(18)19)5-7-3-8-9(4-10(7)17)15-6-16-11(8)14/h3-4,6,17H,5H2,1-2H3,(H,18,19)/p-1 |
| InChIKey | VZYPKZNGEHBNFS-UHFFFAOYSA-M |
| XLogP | 1.31 |
| TPSA | 86.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 279.70 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 3-(4-chloro-7-hydroxyquinazolin-6-yl)-2,2-dimethylpropanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(4-chloro-7-hydroxyquinazolin-6-yl)-2,2-dimethylpropanoate?
The IUPAC name of 3-(4-chloro-7-hydroxyquinazolin-6-yl)-2,2-dimethylpropanoate (CID 170991129) is 3-(4-chloro-7-hydroxyquinazolin-6-yl)-2,2-dimethylpropanoate.
What is the SMILES notation for 3-(4-chloro-7-hydroxyquinazolin-6-yl)-2,2-dimethylpropanoate?
The canonical SMILES for 3-(4-chloro-7-hydroxyquinazolin-6-yl)-2,2-dimethylpropanoate is CC(C)(Cc1cc2c(Cl)ncnc2cc1O)C(=O)[O-].
What is the InChIKey of 3-(4-chloro-7-hydroxyquinazolin-6-yl)-2,2-dimethylpropanoate?
The InChIKey is VZYPKZNGEHBNFS-UHFFFAOYSA-M. The full InChI is InChI=1S/C13H13ClN2O3/c1-13(2,12(18)19)5-7-3-8-9(4-10(7)17)15-6-16-11(8)14/h3-4,6,17H,5H2,1-2H3,(H,18,19)/p-1.
What are the key properties of 3-(4-chloro-7-hydroxyquinazolin-6-yl)-2,2-dimethylpropanoate?
3-(4-chloro-7-hydroxyquinazolin-6-yl)-2,2-dimethylpropanoate has a molecular weight of 279.70 g/mol, XLogP of 1.31, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(4-chloro-7-hydroxyquinazolin-6-yl)-2,2-dimethylpropanoate is sourced from PubChem (CID 170991129), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).