About 6-(trideuteriomethyl)-1,7-dihydropurine-2-thione
6-(trideuteriomethyl)-1,7-dihydropurine-2-thione (PubChem CID 170991229) has the molecular formula C6H6N4S
and a molecular weight of 169.23 g/mol. Its IUPAC name is 6-(trideuteriomethyl)-1,7-dihydropurine-2-thione.
Molecular Properties
| Compound Name | 6-(trideuteriomethyl)-1,7-dihydropurine-2-thione |
| PubChem CID | 170991229 |
| Molecular Formula | C6H6N4S |
| Molecular Weight | 169.23 g/mol |
| Exact Mass | 169.05 |
| IUPAC Name | 6-(trideuteriomethyl)-1,7-dihydropurine-2-thione |
| SMILES | [2H]C([2H])([2H])c1[nH]c(=S)nc2nc[nH]c12 |
| InChI | InChI=1S/C6H6N4S/c1-3-4-5(8-2-7-4)10-6(11)9-3/h2H,1H3,(H2,7,8,9,10,11)/i1D3 |
| InChIKey | RETZWTMHXMVXSV-FIBGUPNXSA-N |
| XLogP | 1.32 |
| TPSA | 57.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 169.23 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 6-(trideuteriomethyl)-1,7-dihydropurine-2-thione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-(trideuteriomethyl)-1,7-dihydropurine-2-thione?
The IUPAC name of 6-(trideuteriomethyl)-1,7-dihydropurine-2-thione (CID 170991229) is 6-(trideuteriomethyl)-1,7-dihydropurine-2-thione.
What is the SMILES notation for 6-(trideuteriomethyl)-1,7-dihydropurine-2-thione?
The canonical SMILES for 6-(trideuteriomethyl)-1,7-dihydropurine-2-thione is [2H]C([2H])([2H])c1[nH]c(=S)nc2nc[nH]c12.
What is the InChIKey of 6-(trideuteriomethyl)-1,7-dihydropurine-2-thione?
The InChIKey is RETZWTMHXMVXSV-FIBGUPNXSA-N. The full InChI is InChI=1S/C6H6N4S/c1-3-4-5(8-2-7-4)10-6(11)9-3/h2H,1H3,(H2,7,8,9,10,11)/i1D3.
What are the key properties of 6-(trideuteriomethyl)-1,7-dihydropurine-2-thione?
6-(trideuteriomethyl)-1,7-dihydropurine-2-thione has a molecular weight of 169.23 g/mol, XLogP of 1.32, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6-(trideuteriomethyl)-1,7-dihydropurine-2-thione is sourced from PubChem (CID 170991229), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).