C7H13N5 — CID 170991274
1,2,2,4,9-pentadeuterio-3-ethylpurin-6-amine (PubChem CID 170991274) has the molecular formula C7H13N5 and a molecular weight of 172.25 g/mol. Its IUPAC name is 1,2,2,4,9-pentadeuterio-3-ethylpurin-6-amine.
| Compound Name | 1,2,2,4,9-pentadeuterio-3-ethylpurin-6-amine |
|---|---|
| PubChem CID | 170991274 |
| Molecular Formula | C7H13N5 |
| Molecular Weight | 172.25 g/mol |
| Exact Mass | 172.15 |
| IUPAC Name | 1,2,2,4,9-pentadeuterio-3-ethylpurin-6-amine |
| SMILES | [2H]N1C(N)=C2N=CN([2H])C2([2H])N(CC)C1([2H])[2H] |
| InChI | InChI=1S/C7H13N5/c1-2-12-4-11-6(8)5-7(12)10-3-9-5/h3,7,11H,2,4,8H2,1H3,(H,9,10)/i4D2,7D/hD2 |
| InChIKey | JTFOCHAIDBEXOA-OSDOEGIOSA-N |
| XLogP | -1.05 |
| TPSA | 65.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 172.25 |
| LogP ≤ 5 | -1.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |