C8H13NO4S — CID 170991316
4-acetamido-1,4,5,5,6,6-hexadeuteriocyclohex-2-ene-1-sulfonic acid (PubChem CID 170991316) has the molecular formula C8H13NO4S and a molecular weight of 225.30 g/mol. Its IUPAC name is 4-acetamido-1,4,5,5,6,6-hexadeuteriocyclohex-2-ene-1-sulfonic acid.
| Compound Name | 4-acetamido-1,4,5,5,6,6-hexadeuteriocyclohex-2-ene-1-sulfonic acid |
|---|---|
| PubChem CID | 170991316 |
| Molecular Formula | C8H13NO4S |
| Molecular Weight | 225.30 g/mol |
| Exact Mass | 225.09 |
| IUPAC Name | 4-acetamido-1,4,5,5,6,6-hexadeuteriocyclohex-2-ene-1-sulfonic acid |
| SMILES | [2H]C1(NC(C)=O)C=CC([2H])(S(=O)(=O)O)C([2H])([2H])C1([2H])[2H] |
| InChI | InChI=1S/C8H13NO4S/c1-6(10)9-7-2-4-8(5-3-7)14(11,12)13/h2,4,7-8H,3,5H2,1H3,(H,9,10)(H,11,12,13)/i3D2,5D2,7D,8D |
| InChIKey | XFCGSXIRDBSEAR-IUDVFFRUSA-N |
| XLogP | 0.10 |
| TPSA | 83.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.30 |
| LogP ≤ 5 | 0.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|