About 2-(1-chloro-2,6-dimethyl-4-phenylcyclohexa-2,4-dien-1-yl)acetic acid
2-(1-chloro-2,6-dimethyl-4-phenylcyclohexa-2,4-dien-1-yl)acetic acid (PubChem CID 170991370) has the molecular formula C16H17ClO2
and a molecular weight of 276.76 g/mol. Its IUPAC name is 2-(1-chloro-2,6-dimethyl-4-phenylcyclohexa-2,4-dien-1-yl)acetic acid.
Molecular Properties
| Compound Name | 2-(1-chloro-2,6-dimethyl-4-phenylcyclohexa-2,4-dien-1-yl)acetic acid |
| PubChem CID | 170991370 |
| Molecular Formula | C16H17ClO2 |
| Molecular Weight | 276.76 g/mol |
| Exact Mass | 276.09 |
| IUPAC Name | 2-(1-chloro-2,6-dimethyl-4-phenylcyclohexa-2,4-dien-1-yl)acetic acid |
| SMILES | CC1=CC(c2ccccc2)=CC(C)C1(Cl)CC(=O)O |
| InChI | InChI=1S/C16H17ClO2/c1-11-8-14(13-6-4-3-5-7-13)9-12(2)16(11,17)10-15(18)19/h3-9,11H,10H2,1-2H3,(H,18,19) |
| InChIKey | ZJMXYXIIKRVFJB-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 276.76 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 2-(1-chloro-2,6-dimethyl-4-phenylcyclohexa-2,4-dien-1-yl)acetic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(1-chloro-2,6-dimethyl-4-phenylcyclohexa-2,4-dien-1-yl)acetic acid?
The IUPAC name of 2-(1-chloro-2,6-dimethyl-4-phenylcyclohexa-2,4-dien-1-yl)acetic acid (CID 170991370) is 2-(1-chloro-2,6-dimethyl-4-phenylcyclohexa-2,4-dien-1-yl)acetic acid.
What is the SMILES notation for 2-(1-chloro-2,6-dimethyl-4-phenylcyclohexa-2,4-dien-1-yl)acetic acid?
The canonical SMILES for 2-(1-chloro-2,6-dimethyl-4-phenylcyclohexa-2,4-dien-1-yl)acetic acid is CC1=CC(c2ccccc2)=CC(C)C1(Cl)CC(=O)O.
What is the InChIKey of 2-(1-chloro-2,6-dimethyl-4-phenylcyclohexa-2,4-dien-1-yl)acetic acid?
The InChIKey is ZJMXYXIIKRVFJB-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H17ClO2/c1-11-8-14(13-6-4-3-5-7-13)9-12(2)16(11,17)10-15(18)19/h3-9,11H,10H2,1-2H3,(H,18,19).
What are the key properties of 2-(1-chloro-2,6-dimethyl-4-phenylcyclohexa-2,4-dien-1-yl)acetic acid?
2-(1-chloro-2,6-dimethyl-4-phenylcyclohexa-2,4-dien-1-yl)acetic acid has a molecular weight of 276.76 g/mol, XLogP of 4.12, 3 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(1-chloro-2,6-dimethyl-4-phenylcyclohexa-2,4-dien-1-yl)acetic acid is sourced from PubChem (CID 170991370), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).