About (1-fluoro-4-phenylcyclohexa-2,4-dien-1-yl)methanol
(1-fluoro-4-phenylcyclohexa-2,4-dien-1-yl)methanol (PubChem CID 170991611) has the molecular formula C13H13FO
and a molecular weight of 204.24 g/mol. Its IUPAC name is (1-fluoro-4-phenylcyclohexa-2,4-dien-1-yl)methanol.
Molecular Properties
| Compound Name | (1-fluoro-4-phenylcyclohexa-2,4-dien-1-yl)methanol |
| PubChem CID | 170991611 |
| Molecular Formula | C13H13FO |
| Molecular Weight | 204.24 g/mol |
| Exact Mass | 204.10 |
| IUPAC Name | (1-fluoro-4-phenylcyclohexa-2,4-dien-1-yl)methanol |
| SMILES | OCC1(F)C=CC(c2ccccc2)=CC1 |
| InChI | InChI=1S/C13H13FO/c14-13(10-15)8-6-12(7-9-13)11-4-2-1-3-5-11/h1-8,15H,9-10H2 |
| InChIKey | JXHGROMVTOELLF-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 204.24 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze (1-fluoro-4-phenylcyclohexa-2,4-dien-1-yl)methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1-fluoro-4-phenylcyclohexa-2,4-dien-1-yl)methanol?
The IUPAC name of (1-fluoro-4-phenylcyclohexa-2,4-dien-1-yl)methanol (CID 170991611) is (1-fluoro-4-phenylcyclohexa-2,4-dien-1-yl)methanol.
What is the SMILES notation for (1-fluoro-4-phenylcyclohexa-2,4-dien-1-yl)methanol?
The canonical SMILES for (1-fluoro-4-phenylcyclohexa-2,4-dien-1-yl)methanol is OCC1(F)C=CC(c2ccccc2)=CC1.
What is the InChIKey of (1-fluoro-4-phenylcyclohexa-2,4-dien-1-yl)methanol?
The InChIKey is JXHGROMVTOELLF-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H13FO/c14-13(10-15)8-6-12(7-9-13)11-4-2-1-3-5-11/h1-8,15H,9-10H2.
What are the key properties of (1-fluoro-4-phenylcyclohexa-2,4-dien-1-yl)methanol?
(1-fluoro-4-phenylcyclohexa-2,4-dien-1-yl)methanol has a molecular weight of 204.24 g/mol, XLogP of 2.73, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (1-fluoro-4-phenylcyclohexa-2,4-dien-1-yl)methanol is sourced from PubChem (CID 170991611), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).