C14H6F8N2 — CID 170991621
2,2,3,3,5,5,6,6-octafluoro-4-phenylcyclohexane-1,1-dicarbonitrile (PubChem CID 170991621) has the molecular formula C14H6F8N2 and a molecular weight of 354.20 g/mol. Its IUPAC name is 2,2,3,3,5,5,6,6-octafluoro-4-phenylcyclohexane-1,1-dicarbonitrile.
| Compound Name | 2,2,3,3,5,5,6,6-octafluoro-4-phenylcyclohexane-1,1-dicarbonitrile |
|---|---|
| PubChem CID | 170991621 |
| Molecular Formula | C14H6F8N2 |
| Molecular Weight | 354.20 g/mol |
| Exact Mass | 354.04 |
| IUPAC Name | 2,2,3,3,5,5,6,6-octafluoro-4-phenylcyclohexane-1,1-dicarbonitrile |
| SMILES | N#CC1(C#N)C(F)(F)C(F)(F)C(c2ccccc2)C(F)(F)C1(F)F |
| InChI | InChI=1S/C14H6F8N2/c15-11(16)9(8-4-2-1-3-5-8)12(17,18)14(21,22)10(6-23,7-24)13(11,19)20/h1-5,9H |
| InChIKey | ZYHXYYMEKWNEJO-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 47.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.20 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|