2-(1-methyl-4-phenylcyclohexa-2,4-dien-1-yl)acetic acid

C15H16O2 — CID 170991718

IUPAC2-(1-methyl-4-phenylcyclohexa-2,4-dien-1-yl)acetic acid
SMILESCC1(CC(=O)O)C=CC(c2ccccc2)=CC1
InChIInChI=1S/C15H16O2/c1-15(11-14(16)17)9-7-13(8-10-15)12-5-3-2-4-6-12/h2-9H,10-11H2,1H3,(H,16,17)
InChIKeyDXLRDCRBNWVQSK-UHFFFAOYSA-N
MW228.29 g/mol
LogP3.51
Rot. Bonds3

About 2-(1-methyl-4-phenylcyclohexa-2,4-dien-1-yl)acetic acid

2-(1-methyl-4-phenylcyclohexa-2,4-dien-1-yl)acetic acid (PubChem CID 170991718) has the molecular formula C15H16O2 and a molecular weight of 228.29 g/mol. Its IUPAC name is 2-(1-methyl-4-phenylcyclohexa-2,4-dien-1-yl)acetic acid.

Molecular Properties

Compound Name2-(1-methyl-4-phenylcyclohexa-2,4-dien-1-yl)acetic acid
PubChem CID170991718
Molecular FormulaC15H16O2
Molecular Weight228.29 g/mol
Exact Mass228.12
IUPAC Name2-(1-methyl-4-phenylcyclohexa-2,4-dien-1-yl)acetic acid
SMILESCC1(CC(=O)O)C=CC(c2ccccc2)=CC1
InChIInChI=1S/C15H16O2/c1-15(11-14(16)17)9-7-13(8-10-15)12-5-3-2-4-6-12/h2-9H,10-11H2,1H3,(H,16,17)
InChIKeyDXLRDCRBNWVQSK-UHFFFAOYSA-N
XLogP3.51
TPSA37.30 Ų
H-Bond Donors1
H-Bond Acceptors1
Rotatable Bonds3
Heavy Atoms17
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500228.29
LogP ≤ 53.51
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 101

Analyze 2-(1-methyl-4-phenylcyclohexa-2,4-dien-1-yl)acetic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-(1-methyl-4-phenylcyclohexa-2,4-dien-1-yl)acetic acid?
The IUPAC name of 2-(1-methyl-4-phenylcyclohexa-2,4-dien-1-yl)acetic acid (CID 170991718) is 2-(1-methyl-4-phenylcyclohexa-2,4-dien-1-yl)acetic acid.
What is the SMILES notation for 2-(1-methyl-4-phenylcyclohexa-2,4-dien-1-yl)acetic acid?
The canonical SMILES for 2-(1-methyl-4-phenylcyclohexa-2,4-dien-1-yl)acetic acid is CC1(CC(=O)O)C=CC(c2ccccc2)=CC1.
What is the InChIKey of 2-(1-methyl-4-phenylcyclohexa-2,4-dien-1-yl)acetic acid?
The InChIKey is DXLRDCRBNWVQSK-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H16O2/c1-15(11-14(16)17)9-7-13(8-10-15)12-5-3-2-4-6-12/h2-9H,10-11H2,1H3,(H,16,17).
What are the key properties of 2-(1-methyl-4-phenylcyclohexa-2,4-dien-1-yl)acetic acid?
2-(1-methyl-4-phenylcyclohexa-2,4-dien-1-yl)acetic acid has a molecular weight of 228.29 g/mol, XLogP of 3.51, 3 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(1-methyl-4-phenylcyclohexa-2,4-dien-1-yl)acetic acid is sourced from PubChem (CID 170991718), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).