About 2-(1-methyl-4-phenylcyclohexa-2,4-dien-1-yl)acetic acid
2-(1-methyl-4-phenylcyclohexa-2,4-dien-1-yl)acetic acid (PubChem CID 170991718) has the molecular formula C15H16O2
and a molecular weight of 228.29 g/mol. Its IUPAC name is 2-(1-methyl-4-phenylcyclohexa-2,4-dien-1-yl)acetic acid.
Molecular Properties
| Compound Name | 2-(1-methyl-4-phenylcyclohexa-2,4-dien-1-yl)acetic acid |
| PubChem CID | 170991718 |
| Molecular Formula | C15H16O2 |
| Molecular Weight | 228.29 g/mol |
| Exact Mass | 228.12 |
| IUPAC Name | 2-(1-methyl-4-phenylcyclohexa-2,4-dien-1-yl)acetic acid |
| SMILES | CC1(CC(=O)O)C=CC(c2ccccc2)=CC1 |
| InChI | InChI=1S/C15H16O2/c1-15(11-14(16)17)9-7-13(8-10-15)12-5-3-2-4-6-12/h2-9H,10-11H2,1H3,(H,16,17) |
| InChIKey | DXLRDCRBNWVQSK-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 228.29 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 2-(1-methyl-4-phenylcyclohexa-2,4-dien-1-yl)acetic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(1-methyl-4-phenylcyclohexa-2,4-dien-1-yl)acetic acid?
The IUPAC name of 2-(1-methyl-4-phenylcyclohexa-2,4-dien-1-yl)acetic acid (CID 170991718) is 2-(1-methyl-4-phenylcyclohexa-2,4-dien-1-yl)acetic acid.
What is the SMILES notation for 2-(1-methyl-4-phenylcyclohexa-2,4-dien-1-yl)acetic acid?
The canonical SMILES for 2-(1-methyl-4-phenylcyclohexa-2,4-dien-1-yl)acetic acid is CC1(CC(=O)O)C=CC(c2ccccc2)=CC1.
What is the InChIKey of 2-(1-methyl-4-phenylcyclohexa-2,4-dien-1-yl)acetic acid?
The InChIKey is DXLRDCRBNWVQSK-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H16O2/c1-15(11-14(16)17)9-7-13(8-10-15)12-5-3-2-4-6-12/h2-9H,10-11H2,1H3,(H,16,17).
What are the key properties of 2-(1-methyl-4-phenylcyclohexa-2,4-dien-1-yl)acetic acid?
2-(1-methyl-4-phenylcyclohexa-2,4-dien-1-yl)acetic acid has a molecular weight of 228.29 g/mol, XLogP of 3.51, 3 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(1-methyl-4-phenylcyclohexa-2,4-dien-1-yl)acetic acid is sourced from PubChem (CID 170991718), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).