C20H26BNO2 — CID 170992881
2-[2,5-dimethyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-4-methylpyridine (PubChem CID 170992881) has the molecular formula C20H26BNO2 and a molecular weight of 323.25 g/mol. Its IUPAC name is 2-[2,5-dimethyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-4-methylpyridine.
| Compound Name | 2-[2,5-dimethyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-4-methylpyridine |
|---|---|
| PubChem CID | 170992881 |
| Molecular Formula | C20H26BNO2 |
| Molecular Weight | 323.25 g/mol |
| Exact Mass | 323.21 |
| IUPAC Name | 2-[2,5-dimethyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-4-methylpyridine |
| SMILES | Cc1ccnc(-c2cc(C)c(B3OC(C)(C)C(C)(C)O3)cc2C)c1 |
| InChI | InChI=1S/C20H26BNO2/c1-13-8-9-22-18(10-13)16-11-15(3)17(12-14(16)2)21-23-19(4,5)20(6,7)24-21/h8-12H,1-7H3 |
| InChIKey | ACARKTVNOAQEKS-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 31.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.25 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|