C17H23N5O3 — CID 170992908
tert-butyl 3-[3-(3-amino-2-methoxyphenyl)-1,2,4-triazol-1-yl]azetidine-1-carboxylate (PubChem CID 170992908) has the molecular formula C17H23N5O3 and a molecular weight of 345.40 g/mol. Its IUPAC name is tert-butyl 3-[3-(3-amino-2-methoxyphenyl)-1,2,4-triazol-1-yl]azetidine-1-carboxylate.
| Compound Name | tert-butyl 3-[3-(3-amino-2-methoxyphenyl)-1,2,4-triazol-1-yl]azetidine-1-carboxylate |
|---|---|
| PubChem CID | 170992908 |
| Molecular Formula | C17H23N5O3 |
| Molecular Weight | 345.40 g/mol |
| Exact Mass | 345.18 |
| IUPAC Name | tert-butyl 3-[3-(3-amino-2-methoxyphenyl)-1,2,4-triazol-1-yl]azetidine-1-carboxylate |
| SMILES | COc1c(N)cccc1-c1ncn(C2CN(C(=O)OC(C)(C)C)C2)n1 |
| InChI | InChI=1S/C17H23N5O3/c1-17(2,3)25-16(23)21-8-11(9-21)22-10-19-15(20-22)12-6-5-7-13(18)14(12)24-4/h5-7,10-11H,8-9,18H2,1-4H3 |
| InChIKey | FPXFXJHDDAHTOZ-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 95.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.40 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|