C13H24N2O5 — CID 170994682
methyl 4-[2-[(2-methylpropan-2-yl)oxycarbonylamino]ethyl]morpholine-3-carboxylate (PubChem CID 170994682) has the molecular formula C13H24N2O5 and a molecular weight of 288.34 g/mol. Its IUPAC name is methyl 4-[2-[(2-methylpropan-2-yl)oxycarbonylamino]ethyl]morpholine-3-carboxylate.
| Compound Name | methyl 4-[2-[(2-methylpropan-2-yl)oxycarbonylamino]ethyl]morpholine-3-carboxylate |
|---|---|
| PubChem CID | 170994682 |
| Molecular Formula | C13H24N2O5 |
| Molecular Weight | 288.34 g/mol |
| Exact Mass | 288.17 |
| IUPAC Name | methyl 4-[2-[(2-methylpropan-2-yl)oxycarbonylamino]ethyl]morpholine-3-carboxylate |
| SMILES | COC(=O)C1COCCN1CCNC(=O)OC(C)(C)C |
| InChI | InChI=1S/C13H24N2O5/c1-13(2,3)20-12(17)14-5-6-15-7-8-19-9-10(15)11(16)18-4/h10H,5-9H2,1-4H3,(H,14,17) |
| InChIKey | BQISSBQIQHXBDN-UHFFFAOYSA-N |
| XLogP | 0.38 |
| TPSA | 77.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.34 |
| LogP ≤ 5 | 0.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |