C15H21F3N4O — CID 170994837
4-amino-N-[2-(4-methylpiperazin-1-yl)ethyl]-2-(trifluoromethyl)benzamide (PubChem CID 170994837) has the molecular formula C15H21F3N4O and a molecular weight of 330.35 g/mol. Its IUPAC name is 4-amino-N-[2-(4-methylpiperazin-1-yl)ethyl]-2-(trifluoromethyl)benzamide.
| Compound Name | 4-amino-N-[2-(4-methylpiperazin-1-yl)ethyl]-2-(trifluoromethyl)benzamide |
|---|---|
| PubChem CID | 170994837 |
| Molecular Formula | C15H21F3N4O |
| Molecular Weight | 330.35 g/mol |
| Exact Mass | 330.17 |
| IUPAC Name | 4-amino-N-[2-(4-methylpiperazin-1-yl)ethyl]-2-(trifluoromethyl)benzamide |
| SMILES | CN1CCN(CCNC(=O)c2ccc(N)cc2C(F)(F)F)CC1 |
| InChI | InChI=1S/C15H21F3N4O/c1-21-6-8-22(9-7-21)5-4-20-14(23)12-3-2-11(19)10-13(12)15(16,17)18/h2-3,10H,4-9,19H2,1H3,(H,20,23) |
| InChIKey | ZDBQHJNVBKBDEL-UHFFFAOYSA-N |
| XLogP | 1.26 |
| TPSA | 61.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.35 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|