C12H15BrClN3O3 — CID 170995616
(2-bromo-4-nitrophenyl)-[(3S)-3-methylpiperazin-1-yl]methanone;hydrochloride (PubChem CID 170995616) has the molecular formula C12H15BrClN3O3 and a molecular weight of 364.63 g/mol. Its IUPAC name is (2-bromo-4-nitrophenyl)-[(3S)-3-methylpiperazin-1-yl]methanone;hydrochloride.
| Compound Name | (2-bromo-4-nitrophenyl)-[(3S)-3-methylpiperazin-1-yl]methanone;hydrochloride |
|---|---|
| PubChem CID | 170995616 |
| Molecular Formula | C12H15BrClN3O3 |
| Molecular Weight | 364.63 g/mol |
| Exact Mass | 363.00 |
| IUPAC Name | (2-bromo-4-nitrophenyl)-[(3S)-3-methylpiperazin-1-yl]methanone;hydrochloride |
| SMILES | C[C@H]1CN(C(=O)c2ccc([N+](=O)[O-])cc2Br)CCN1.Cl |
| InChI | InChI=1S/C12H14BrN3O3.ClH/c1-8-7-15(5-4-14-8)12(17)10-3-2-9(16(18)19)6-11(10)13;/h2-3,6,8,14H,4-5,7H2,1H3;1H/t8-;/m0./s1 |
| InChIKey | NKFIQCLAXNYFBJ-QRPNPIFTSA-N |
| XLogP | 2.21 |
| TPSA | 75.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.63 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|