About 3-acetamido-2,4,6-triiodo-5-(trideuteriomethylcarbamoyl)benzoic acid
3-acetamido-2,4,6-triiodo-5-(trideuteriomethylcarbamoyl)benzoic acid (PubChem CID 170996933) has the molecular formula C11H9I3N2O4
and a molecular weight of 616.93 g/mol. Its IUPAC name is 3-acetamido-2,4,6-triiodo-5-(trideuteriomethylcarbamoyl)benzoic acid.
Molecular Properties
| Compound Name | 3-acetamido-2,4,6-triiodo-5-(trideuteriomethylcarbamoyl)benzoic acid |
| PubChem CID | 170996933 |
| Molecular Formula | C11H9I3N2O4 |
| Molecular Weight | 616.93 g/mol |
| Exact Mass | 616.79 |
| IUPAC Name | 3-acetamido-2,4,6-triiodo-5-(trideuteriomethylcarbamoyl)benzoic acid |
| SMILES | [2H]C([2H])([2H])NC(=O)c1c(I)c(NC(C)=O)c(I)c(C(=O)O)c1I |
| InChI | InChI=1S/C11H9I3N2O4/c1-3(17)16-9-7(13)4(10(18)15-2)6(12)5(8(9)14)11(19)20/h1-2H3,(H,15,18)(H,16,17)(H,19,20)/i2D3 |
| InChIKey | UXIGWFXRQKWHHA-BMSJAHLVSA-N |
| XLogP | 2.52 |
| TPSA | 95.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 616.93 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 3-acetamido-2,4,6-triiodo-5-(trideuteriomethylcarbamoyl)benzoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-acetamido-2,4,6-triiodo-5-(trideuteriomethylcarbamoyl)benzoic acid?
The IUPAC name of 3-acetamido-2,4,6-triiodo-5-(trideuteriomethylcarbamoyl)benzoic acid (CID 170996933) is 3-acetamido-2,4,6-triiodo-5-(trideuteriomethylcarbamoyl)benzoic acid.
What is the SMILES notation for 3-acetamido-2,4,6-triiodo-5-(trideuteriomethylcarbamoyl)benzoic acid?
The canonical SMILES for 3-acetamido-2,4,6-triiodo-5-(trideuteriomethylcarbamoyl)benzoic acid is [2H]C([2H])([2H])NC(=O)c1c(I)c(NC(C)=O)c(I)c(C(=O)O)c1I.
What is the InChIKey of 3-acetamido-2,4,6-triiodo-5-(trideuteriomethylcarbamoyl)benzoic acid?
The InChIKey is UXIGWFXRQKWHHA-BMSJAHLVSA-N. The full InChI is InChI=1S/C11H9I3N2O4/c1-3(17)16-9-7(13)4(10(18)15-2)6(12)5(8(9)14)11(19)20/h1-2H3,(H,15,18)(H,16,17)(H,19,20)/i2D3.
What are the key properties of 3-acetamido-2,4,6-triiodo-5-(trideuteriomethylcarbamoyl)benzoic acid?
3-acetamido-2,4,6-triiodo-5-(trideuteriomethylcarbamoyl)benzoic acid has a molecular weight of 616.93 g/mol, XLogP of 2.52, 4 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-acetamido-2,4,6-triiodo-5-(trideuteriomethylcarbamoyl)benzoic acid is sourced from PubChem (CID 170996933), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).