C18H24O3 — CID 170997458
(8R,9S,13S,14S,16S,17R)-2,4,16-trideuterio-13-methyl-7,8,9,11,12,14,15,17-octahydro-6H-cyclopenta[a]phenanthrene-3,16,17-triol (PubChem CID 170997458) has the molecular formula C18H24O3 and a molecular weight of 291.41 g/mol. Its IUPAC name is (8R,9S,13S,14S,16S,17R)-2,4,16-trideuterio-13-methyl-7,8,9,11,12,14,15,17-octahydro-6H-cyclopenta[a]phenanthrene-3,16,17-triol.
| Compound Name | (8R,9S,13S,14S,16S,17R)-2,4,16-trideuterio-13-methyl-7,8,9,11,12,14,15,17-octahydro-6H-cyclopenta[a]phenanthrene-3,16,17-triol |
|---|---|
| PubChem CID | 170997458 |
| Molecular Formula | C18H24O3 |
| Molecular Weight | 291.41 g/mol |
| Exact Mass | 291.19 |
| IUPAC Name | (8R,9S,13S,14S,16S,17R)-2,4,16-trideuterio-13-methyl-7,8,9,11,12,14,15,17-octahydro-6H-cyclopenta[a]phenanthrene-3,16,17-triol |
| SMILES | [2H]c1cc2c(c([2H])c1O)CC[C@@H]1[C@@H]2CC[C@]2(C)[C@@H](O)[C@@]([2H])(O)C[C@@H]12 |
| InChI | InChI=1S/C18H24O3/c1-18-7-6-13-12-5-3-11(19)8-10(12)2-4-14(13)15(18)9-16(20)17(18)21/h3,5,8,13-17,19-21H,2,4,6-7,9H2,1H3/t13-,14-,15+,16+,17+,18+/m1/s1/i3D,8D,16D |
| InChIKey | PROQIPRRNZUXQM-AFZAGIBHSA-N |
| XLogP | 2.58 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.41 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |