C11H16BrNO — CID 170999674
3-methoxy-5,6,7,8-tetrahydronaphthalen-2-amine;hydrobromide (PubChem CID 170999674) has the molecular formula C11H16BrNO and a molecular weight of 258.16 g/mol. Its IUPAC name is 3-methoxy-5,6,7,8-tetrahydronaphthalen-2-amine;hydrobromide.
| Compound Name | 3-methoxy-5,6,7,8-tetrahydronaphthalen-2-amine;hydrobromide |
|---|---|
| PubChem CID | 170999674 |
| Molecular Formula | C11H16BrNO |
| Molecular Weight | 258.16 g/mol |
| Exact Mass | 257.04 |
| IUPAC Name | 3-methoxy-5,6,7,8-tetrahydronaphthalen-2-amine;hydrobromide |
| SMILES | Br.COc1cc2c(cc1N)CCCC2 |
| InChI | InChI=1S/C11H15NO.BrH/c1-13-11-7-9-5-3-2-4-8(9)6-10(11)12;/h6-7H,2-5,12H2,1H3;1H |
| InChIKey | ATVNOXMNEDTLJY-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.16 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|