About N-[(4-chlorofuro[3,2-c]pyridin-2-yl)methylidene]hydroxylamine
N-[(4-chlorofuro[3,2-c]pyridin-2-yl)methylidene]hydroxylamine (PubChem CID 170999745) has the molecular formula C8H5ClN2O2
and a molecular weight of 196.59 g/mol. Its IUPAC name is N-[(4-chlorofuro[3,2-c]pyridin-2-yl)methylidene]hydroxylamine.
Molecular Properties
| Compound Name | N-[(4-chlorofuro[3,2-c]pyridin-2-yl)methylidene]hydroxylamine |
| PubChem CID | 170999745 |
| Molecular Formula | C8H5ClN2O2 |
| Molecular Weight | 196.59 g/mol |
| Exact Mass | 196.00 |
| IUPAC Name | N-[(4-chlorofuro[3,2-c]pyridin-2-yl)methylidene]hydroxylamine |
| SMILES | ON=Cc1cc2c(Cl)nccc2o1 |
| InChI | InChI=1S/C8H5ClN2O2/c9-8-6-3-5(4-11-12)13-7(6)1-2-10-8/h1-4,12H |
| InChIKey | BWXKPQSUXIAYDY-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 58.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 196.59 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N-[(4-chlorofuro[3,2-c]pyridin-2-yl)methylidene]hydroxylamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(4-chlorofuro[3,2-c]pyridin-2-yl)methylidene]hydroxylamine?
The IUPAC name of N-[(4-chlorofuro[3,2-c]pyridin-2-yl)methylidene]hydroxylamine (CID 170999745) is N-[(4-chlorofuro[3,2-c]pyridin-2-yl)methylidene]hydroxylamine.
What is the SMILES notation for N-[(4-chlorofuro[3,2-c]pyridin-2-yl)methylidene]hydroxylamine?
The canonical SMILES for N-[(4-chlorofuro[3,2-c]pyridin-2-yl)methylidene]hydroxylamine is ON=Cc1cc2c(Cl)nccc2o1.
What is the InChIKey of N-[(4-chlorofuro[3,2-c]pyridin-2-yl)methylidene]hydroxylamine?
The InChIKey is BWXKPQSUXIAYDY-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H5ClN2O2/c9-8-6-3-5(4-11-12)13-7(6)1-2-10-8/h1-4,12H.
What are the key properties of N-[(4-chlorofuro[3,2-c]pyridin-2-yl)methylidene]hydroxylamine?
N-[(4-chlorofuro[3,2-c]pyridin-2-yl)methylidene]hydroxylamine has a molecular weight of 196.59 g/mol, XLogP of 2.29, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(4-chlorofuro[3,2-c]pyridin-2-yl)methylidene]hydroxylamine is sourced from PubChem (CID 170999745), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).