C8H5ClF2O3S — CID 170999784
2-chloro-1-(2,3-dihydrothieno[3,4-b][1,4]dioxin-5-yl)-2,2-difluoroethanone (PubChem CID 170999784) has the molecular formula C8H5ClF2O3S and a molecular weight of 254.64 g/mol. Its IUPAC name is 2-chloro-1-(2,3-dihydrothieno[3,4-b][1,4]dioxin-5-yl)-2,2-difluoroethanone.
| Compound Name | 2-chloro-1-(2,3-dihydrothieno[3,4-b][1,4]dioxin-5-yl)-2,2-difluoroethanone |
|---|---|
| PubChem CID | 170999784 |
| Molecular Formula | C8H5ClF2O3S |
| Molecular Weight | 254.64 g/mol |
| Exact Mass | 253.96 |
| IUPAC Name | 2-chloro-1-(2,3-dihydrothieno[3,4-b][1,4]dioxin-5-yl)-2,2-difluoroethanone |
| SMILES | O=C(c1scc2c1OCCO2)C(F)(F)Cl |
| InChI | InChI=1S/C8H5ClF2O3S/c9-8(10,11)7(12)6-5-4(3-15-6)13-1-2-14-5/h3H,1-2H2 |
| InChIKey | PORZDSKQJXKESM-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.64 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|