About zinc;1-(phenylmethyl)piperidine;iodide
zinc;1-(phenylmethyl)piperidine;iodide (PubChem CID 170999956) has the molecular formula C12H16INZn
and a molecular weight of 366.56 g/mol. Its IUPAC name is zinc;1-(phenylmethyl)piperidine;iodide.
Molecular Properties
| Compound Name | zinc;1-(phenylmethyl)piperidine;iodide |
| PubChem CID | 170999956 |
| Molecular Formula | C12H16INZn |
| Molecular Weight | 366.56 g/mol |
| Exact Mass | 364.96 |
| IUPAC Name | zinc;1-(phenylmethyl)piperidine;iodide |
| SMILES | [I-].[Zn+2].[c-]1ccc(CN2CCCCC2)cc1 |
| InChI | InChI=1S/C12H16N.HI.Zn/c1-3-7-12(8-4-1)11-13-9-5-2-6-10-13;;/h3-4,7-8H,2,5-6,9-11H2;1H;/q-1;;+2/p-1 |
| InChIKey | MWCFKOUVTBULJQ-UHFFFAOYSA-M |
| XLogP | -0.53 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 366.56 |
| LogP ≤ 5 | -0.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze zinc;1-(phenylmethyl)piperidine;iodide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of zinc;1-(phenylmethyl)piperidine;iodide?
The IUPAC name of zinc;1-(phenylmethyl)piperidine;iodide (CID 170999956) is zinc;1-(phenylmethyl)piperidine;iodide.
What is the SMILES notation for zinc;1-(phenylmethyl)piperidine;iodide?
The canonical SMILES for zinc;1-(phenylmethyl)piperidine;iodide is [I-].[Zn+2].[c-]1ccc(CN2CCCCC2)cc1.
What is the InChIKey of zinc;1-(phenylmethyl)piperidine;iodide?
The InChIKey is MWCFKOUVTBULJQ-UHFFFAOYSA-M. The full InChI is InChI=1S/C12H16N.HI.Zn/c1-3-7-12(8-4-1)11-13-9-5-2-6-10-13;;/h3-4,7-8H,2,5-6,9-11H2;1H;/q-1;;+2/p-1.
What are the key properties of zinc;1-(phenylmethyl)piperidine;iodide?
zinc;1-(phenylmethyl)piperidine;iodide has a molecular weight of 366.56 g/mol, XLogP of -0.53, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for zinc;1-(phenylmethyl)piperidine;iodide is sourced from PubChem (CID 170999956), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).