2-bromo-5-iodo-4-methylbenzenesulfonyl chloride

C7H5BrClIO2S — CID 171000953

IUPAC2-bromo-5-iodo-4-methylbenzenesulfonyl chloride
SMILESCc1cc(Br)c(S(=O)(=O)Cl)cc1I
InChIInChI=1S/C7H5BrClIO2S/c1-4-2-5(8)7(3-6(4)10)13(9,11)12/h2-3H,1H3
InChIKeyNQXVUPZHGDEQRE-UHFFFAOYSA-N
MW395.44 g/mol
LogP3.29
Rot. Bonds1

About 2-bromo-5-iodo-4-methylbenzenesulfonyl chloride

2-bromo-5-iodo-4-methylbenzenesulfonyl chloride (PubChem CID 171000953) has the molecular formula C7H5BrClIO2S and a molecular weight of 395.44 g/mol. Its IUPAC name is 2-bromo-5-iodo-4-methylbenzenesulfonyl chloride.

Molecular Properties

Compound Name2-bromo-5-iodo-4-methylbenzenesulfonyl chloride
PubChem CID171000953
Molecular FormulaC7H5BrClIO2S
Molecular Weight395.44 g/mol
Exact Mass393.79
IUPAC Name2-bromo-5-iodo-4-methylbenzenesulfonyl chloride
SMILESCc1cc(Br)c(S(=O)(=O)Cl)cc1I
InChIInChI=1S/C7H5BrClIO2S/c1-4-2-5(8)7(3-6(4)10)13(9,11)12/h2-3H,1H3
InChIKeyNQXVUPZHGDEQRE-UHFFFAOYSA-N
XLogP3.29
TPSA34.14 Ų
H-Bond Donors
H-Bond Acceptors2
Rotatable Bonds1
Heavy Atoms13
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500395.44
LogP ≤ 53.29
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 102

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'iodine', 'substructure': 'N/A'}

Analyze 2-bromo-5-iodo-4-methylbenzenesulfonyl chloride with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-bromo-5-iodo-4-methylbenzenesulfonyl chloride?
The IUPAC name of 2-bromo-5-iodo-4-methylbenzenesulfonyl chloride (CID 171000953) is 2-bromo-5-iodo-4-methylbenzenesulfonyl chloride.
What is the SMILES notation for 2-bromo-5-iodo-4-methylbenzenesulfonyl chloride?
The canonical SMILES for 2-bromo-5-iodo-4-methylbenzenesulfonyl chloride is Cc1cc(Br)c(S(=O)(=O)Cl)cc1I.
What is the InChIKey of 2-bromo-5-iodo-4-methylbenzenesulfonyl chloride?
The InChIKey is NQXVUPZHGDEQRE-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H5BrClIO2S/c1-4-2-5(8)7(3-6(4)10)13(9,11)12/h2-3H,1H3.
What are the key properties of 2-bromo-5-iodo-4-methylbenzenesulfonyl chloride?
2-bromo-5-iodo-4-methylbenzenesulfonyl chloride has a molecular weight of 395.44 g/mol, XLogP of 3.29, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-bromo-5-iodo-4-methylbenzenesulfonyl chloride is sourced from PubChem (CID 171000953), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).