C8H5Br2IO — CID 171001824
1-(2,6-dibromo-4-iodophenyl)ethanone (PubChem CID 171001824) has the molecular formula C8H5Br2IO and a molecular weight of 403.84 g/mol. Its IUPAC name is 1-(2,6-dibromo-4-iodophenyl)ethanone.
| Compound Name | 1-(2,6-dibromo-4-iodophenyl)ethanone |
|---|---|
| PubChem CID | 171001824 |
| Molecular Formula | C8H5Br2IO |
| Molecular Weight | 403.84 g/mol |
| Exact Mass | 401.78 |
| IUPAC Name | 1-(2,6-dibromo-4-iodophenyl)ethanone |
| SMILES | CC(=O)c1c(Br)cc(I)cc1Br |
| InChI | InChI=1S/C8H5Br2IO/c1-4(12)8-6(9)2-5(11)3-7(8)10/h2-3H,1H3 |
| InChIKey | POZGMQXFKQKWLX-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.84 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|