C9H5Br2F3O — CID 171005665
1-[2,5-dibromo-4-(trifluoromethyl)phenyl]ethanone (PubChem CID 171005665) has the molecular formula C9H5Br2F3O and a molecular weight of 345.94 g/mol. Its IUPAC name is 1-[2,5-dibromo-4-(trifluoromethyl)phenyl]ethanone.
| Compound Name | 1-[2,5-dibromo-4-(trifluoromethyl)phenyl]ethanone |
|---|---|
| PubChem CID | 171005665 |
| Molecular Formula | C9H5Br2F3O |
| Molecular Weight | 345.94 g/mol |
| Exact Mass | 343.87 |
| IUPAC Name | 1-[2,5-dibromo-4-(trifluoromethyl)phenyl]ethanone |
| SMILES | CC(=O)c1cc(Br)c(C(F)(F)F)cc1Br |
| InChI | InChI=1S/C9H5Br2F3O/c1-4(15)5-2-8(11)6(3-7(5)10)9(12,13)14/h2-3H,1H3 |
| InChIKey | RKMYVYXSMAAWDS-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.94 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |