C9H5F5O2 — CID 171006054
1-[2,4-difluoro-5-(trifluoromethoxy)phenyl]ethanone (PubChem CID 171006054) has the molecular formula C9H5F5O2 and a molecular weight of 240.13 g/mol. Its IUPAC name is 1-[2,4-difluoro-5-(trifluoromethoxy)phenyl]ethanone.
| Compound Name | 1-[2,4-difluoro-5-(trifluoromethoxy)phenyl]ethanone |
|---|---|
| PubChem CID | 171006054 |
| Molecular Formula | C9H5F5O2 |
| Molecular Weight | 240.13 g/mol |
| Exact Mass | 240.02 |
| IUPAC Name | 1-[2,4-difluoro-5-(trifluoromethoxy)phenyl]ethanone |
| SMILES | CC(=O)c1cc(OC(F)(F)F)c(F)cc1F |
| InChI | InChI=1S/C9H5F5O2/c1-4(15)5-2-8(16-9(12,13)14)7(11)3-6(5)10/h2-3H,1H3 |
| InChIKey | AOXPJWRFSHMWQH-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.13 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |