C19H21N3O2 — CID 17100754
N-[2-methyl-4-([1,3]oxazolo[4,5-b]pyridin-2-yl)phenyl]hexanamide (PubChem CID 17100754) has the molecular formula C19H21N3O2 and a molecular weight of 323.40 g/mol. Its IUPAC name is N-[2-methyl-4-([1,3]oxazolo[4,5-b]pyridin-2-yl)phenyl]hexanamide.
| Compound Name | N-[2-methyl-4-([1,3]oxazolo[4,5-b]pyridin-2-yl)phenyl]hexanamide |
|---|---|
| PubChem CID | 17100754 |
| Molecular Formula | C19H21N3O2 |
| Molecular Weight | 323.40 g/mol |
| Exact Mass | 323.16 |
| IUPAC Name | N-[2-methyl-4-([1,3]oxazolo[4,5-b]pyridin-2-yl)phenyl]hexanamide |
| SMILES | CCCCCC(=O)Nc1ccc(-c2nc3ncccc3o2)cc1C |
| InChI | InChI=1S/C19H21N3O2/c1-3-4-5-8-17(23)21-15-10-9-14(12-13(15)2)19-22-18-16(24-19)7-6-11-20-18/h6-7,9-12H,3-5,8H2,1-2H3,(H,21,23) |
| InChIKey | LNMSHTXOJBGADD-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 68.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.40 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|